C43H54I2N2O4S4 — CID 24786885
9,21-ditert-butyl-7,23-bis(iodomethyl)-13,17-bis-(4-methylphenyl)sulfonyl-2,5-dithia-13,17-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaene (PubChem CID 24786885) has the molecular formula C43H54I2N2O4S4 and a molecular weight of 1044.99 g/mol. Its IUPAC name is 9,21-ditert-butyl-7,23-bis(iodomethyl)-13,17-bis-(4-methylphenyl)sulfonyl-2,5-dithia-13,17-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaene.
| Compound Name | 9,21-ditert-butyl-7,23-bis(iodomethyl)-13,17-bis-(4-methylphenyl)sulfonyl-2,5-dithia-13,17-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaene |
|---|---|
| PubChem CID | 24786885 |
| Molecular Formula | C43H54I2N2O4S4 |
| Molecular Weight | 1044.99 g/mol |
| Exact Mass | 1044.11 |
| IUPAC Name | 9,21-ditert-butyl-7,23-bis(iodomethyl)-13,17-bis-(4-methylphenyl)sulfonyl-2,5-dithia-13,17-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaene |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(S(=O)(=O)c3ccc(C)cc3)Cc3cc(C(C)(C)C)cc(CI)c3SCCSc3c(CI)cc(C(C)(C)C)cc3C2)cc1 |
| InChI | InChI=1S/C43H54I2N2O4S4/c1-30-10-14-38(15-11-30)54(48,49)46-18-9-19-47(55(50,51)39-16-12-31(2)13-17-39)29-35-25-37(43(6,7)8)23-33(27-45)41(35)53-21-20-52-40-32(26-44)22-36(42(3,4)5)24-34(40)28-46/h10-17,22-25H,9,18-21,26-29H2,1-8H3 |
| InChIKey | JGSMNLHPCJHGMV-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1044.99 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|