C24H24IN5O3 — CID 24787209
tert-butyl N-[5-cyano-4-(4-iodoanilino)-6-phenylmethoxypyrimidin-2-yl]-N-methylcarbamate (PubChem CID 24787209) has the molecular formula C24H24IN5O3 and a molecular weight of 557.39 g/mol. Its IUPAC name is tert-butyl N-[5-cyano-4-(4-iodoanilino)-6-phenylmethoxypyrimidin-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[5-cyano-4-(4-iodoanilino)-6-phenylmethoxypyrimidin-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 24787209 |
| Molecular Formula | C24H24IN5O3 |
| Molecular Weight | 557.39 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | tert-butyl N-[5-cyano-4-(4-iodoanilino)-6-phenylmethoxypyrimidin-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1nc(Nc2ccc(I)cc2)c(C#N)c(OCc2ccccc2)n1 |
| InChI | InChI=1S/C24H24IN5O3/c1-24(2,3)33-23(31)30(4)22-28-20(27-18-12-10-17(25)11-13-18)19(14-26)21(29-22)32-15-16-8-6-5-7-9-16/h5-13H,15H2,1-4H3,(H,27,28,29) |
| InChIKey | OXPXMBNSENJIBM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.39 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|