C11H16O4 — CID 24787768
(2S,3R)-2-[2-(furan-2-yl)ethoxy]oxan-3-ol (PubChem CID 24787768) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (2S,3R)-2-[2-(furan-2-yl)ethoxy]oxan-3-ol.
| Compound Name | (2S,3R)-2-[2-(furan-2-yl)ethoxy]oxan-3-ol |
|---|---|
| PubChem CID | 24787768 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (2S,3R)-2-[2-(furan-2-yl)ethoxy]oxan-3-ol |
| SMILES | O[C@@H]1CCCO[C@H]1OCCc1ccco1 |
| InChI | InChI=1S/C11H16O4/c12-10-4-2-7-14-11(10)15-8-5-9-3-1-6-13-9/h1,3,6,10-12H,2,4-5,7-8H2/t10-,11+/m1/s1 |
| InChIKey | QKLNSRCRGHKBIZ-MNOVXSKESA-N |
| XLogP | 1.34 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |