C21H26F3N5O — CID 24790762
2-pyrazol-1-yl-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]ethanone (PubChem CID 24790762) has the molecular formula C21H26F3N5O and a molecular weight of 421.47 g/mol. Its IUPAC name is 2-pyrazol-1-yl-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-pyrazol-1-yl-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 24790762 |
| Molecular Formula | C21H26F3N5O |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-pyrazol-1-yl-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]ethanone |
| SMILES | O=C(Cn1cccn1)N1CCCC(N2CCN(c3cccc(C(F)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C21H26F3N5O/c22-21(23,24)17-4-1-5-18(14-17)26-10-12-27(13-11-26)19-6-2-8-28(15-19)20(30)16-29-9-3-7-25-29/h1,3-5,7,9,14,19H,2,6,8,10-13,15-16H2 |
| InChIKey | MGROXOQHEJWFCD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |