C18H14N2O2S2 — CID 2479188
1,3-benzothiazol-2-ylmethyl 3-(1,3-benzothiazol-2-yl)propanoate (PubChem CID 2479188) has the molecular formula C18H14N2O2S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-(1,3-benzothiazol-2-yl)propanoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 3-(1,3-benzothiazol-2-yl)propanoate |
|---|---|
| PubChem CID | 2479188 |
| Molecular Formula | C18H14N2O2S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 3-(1,3-benzothiazol-2-yl)propanoate |
| SMILES | O=C(CCc1nc2ccccc2s1)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H14N2O2S2/c21-18(10-9-16-19-12-5-1-3-7-14(12)23-16)22-11-17-20-13-6-2-4-8-15(13)24-17/h1-8H,9-11H2 |
| InChIKey | DZIKCLFZDBJEMP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |