C11H9NO2S2 — CID 2947593
3-(1,3-benzothiazol-2-ylsulfanyl)oxolan-2-one (PubChem CID 2947593) has the molecular formula C11H9NO2S2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)oxolan-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)oxolan-2-one |
|---|---|
| PubChem CID | 2947593 |
| Molecular Formula | C11H9NO2S2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)oxolan-2-one |
| SMILES | O=C1OCCC1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H9NO2S2/c13-10-9(5-6-14-10)16-11-12-7-3-1-2-4-8(7)15-11/h1-4,9H,5-6H2 |
| InChIKey | SNXKWVIPUGCIJU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |