C23H22N2O5 — CID 24800602
7-(4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine (PubChem CID 24800602) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine.
| Compound Name | 7-(4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 24800602 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 7-(4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine |
| SMILES | COc1ccc(-c2cccc3nc(Nc4cc(OC)c(OC)c(OC)c4)oc23)cc1 |
| InChI | InChI=1S/C23H22N2O5/c1-26-16-10-8-14(9-11-16)17-6-5-7-18-21(17)30-23(25-18)24-15-12-19(27-2)22(29-4)20(13-15)28-3/h5-13H,1-4H3,(H,24,25) |
| InChIKey | XYSGFDULUQQBMY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |