C25H21N3O4 — CID 24800776
7-quinolin-6-yl-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine (PubChem CID 24800776) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is 7-quinolin-6-yl-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine.
| Compound Name | 7-quinolin-6-yl-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 24800776 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 7-quinolin-6-yl-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine |
| SMILES | COc1cc(Nc2nc3cccc(-c4ccc5ncccc5c4)c3o2)cc(OC)c1OC |
| InChI | InChI=1S/C25H21N3O4/c1-29-21-13-17(14-22(30-2)24(21)31-3)27-25-28-20-8-4-7-18(23(20)32-25)15-9-10-19-16(12-15)6-5-11-26-19/h4-14H,1-3H3,(H,27,28) |
| InChIKey | VVOLBRCSXARCDJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |