C22H44N2O5Si — CID 24813001
tert-butyl N-[3-[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]propyl]carbamate (PubChem CID 24813001) has the molecular formula C22H44N2O5Si and a molecular weight of 444.69 g/mol. Its IUPAC name is tert-butyl N-[3-[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]propyl]carbamate |
|---|---|
| PubChem CID | 24813001 |
| Molecular Formula | C22H44N2O5Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | tert-butyl N-[3-[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN1C[C@@H]2OC(C)(C)O[C@@H]2[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44N2O5Si/c1-20(2,3)29-19(25)23-12-11-13-24-14-17-18(28-22(7,8)27-17)16(24)15-26-30(9,10)21(4,5)6/h16-18H,11-15H2,1-10H3,(H,23,25)/t16-,17+,18-/m1/s1 |
| InChIKey | IFLXNEVBYNTSFY-FGTMMUONSA-N |
| XLogP | 4.13 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|