C24H24FN5O8 — CID 24813405
[(2R,3R,4S,5S,6R)-3,5-diacetyloxy-6-(6-benzamidopurin-9-yl)-4-fluorooxan-2-yl]methyl acetate (PubChem CID 24813405) has the molecular formula C24H24FN5O8 and a molecular weight of 529.48 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,5-diacetyloxy-6-(6-benzamidopurin-9-yl)-4-fluorooxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,5-diacetyloxy-6-(6-benzamidopurin-9-yl)-4-fluorooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 24813405 |
| Molecular Formula | C24H24FN5O8 |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,5-diacetyloxy-6-(6-benzamidopurin-9-yl)-4-fluorooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](OC(C)=O)[C@@H](F)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H24FN5O8/c1-12(31)35-9-16-19(36-13(2)32)17(25)20(37-14(3)33)24(38-16)30-11-28-18-21(26-10-27-22(18)30)29-23(34)15-7-5-4-6-8-15/h4-8,10-11,16-17,19-20,24H,9H2,1-3H3,(H,26,27,29,34)/t16-,17+,19-,20-,24-/m1/s1 |
| InChIKey | KYUWFIAPDKRFCI-YPTMSUPPSA-N |
| XLogP | 1.74 |
| TPSA | 160.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|