C14H26O4 — CID 24813660
(E,2S,3S,6S,7R,8S)-3,9-dihydroxy-7-methoxy-2,4,6,8-tetramethylnon-4-enal (PubChem CID 24813660) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is (E,2S,3S,6S,7R,8S)-3,9-dihydroxy-7-methoxy-2,4,6,8-tetramethylnon-4-enal.
| Compound Name | (E,2S,3S,6S,7R,8S)-3,9-dihydroxy-7-methoxy-2,4,6,8-tetramethylnon-4-enal |
|---|---|
| PubChem CID | 24813660 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (E,2S,3S,6S,7R,8S)-3,9-dihydroxy-7-methoxy-2,4,6,8-tetramethylnon-4-enal |
| SMILES | CO[C@H]([C@@H](C)/C=C(\C)[C@@H](O)[C@H](C)C=O)[C@@H](C)CO |
| InChI | InChI=1S/C14H26O4/c1-9(13(17)11(3)7-15)6-10(2)14(18-5)12(4)8-16/h6-7,10-14,16-17H,8H2,1-5H3/b9-6+/t10-,11+,12-,13+,14+/m0/s1 |
| InChIKey | BVBLOVPDTSNOGS-BFIFPKBDSA-N |
| XLogP | 1.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|