C13H24O3 — CID 11953515
(E,6R)-3-hydroxy-2,4,6,8-tetramethylnon-4-enoic acid (PubChem CID 11953515) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (E,6R)-3-hydroxy-2,4,6,8-tetramethylnon-4-enoic acid.
| Compound Name | (E,6R)-3-hydroxy-2,4,6,8-tetramethylnon-4-enoic acid |
|---|---|
| PubChem CID | 11953515 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (E,6R)-3-hydroxy-2,4,6,8-tetramethylnon-4-enoic acid |
| SMILES | C/C(=C\[C@H](C)CC(C)C)C(O)C(C)C(=O)O |
| InChI | InChI=1S/C13H24O3/c1-8(2)6-9(3)7-10(4)12(14)11(5)13(15)16/h7-9,11-12,14H,6H2,1-5H3,(H,15,16)/b10-7+/t9-,11?,12?/m1/s1 |
| InChIKey | FBUHPIHKLTYWFO-IQNZGNTRSA-N |
| XLogP | 2.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|