C30H52O7 — CID 162920251
(2R,3R,4E,6S,7S,8E,10S,11S,12E,14S,15R,16E,18R,20S)-3,7,11,15-tetrahydroxy-18-(hydroxymethyl)-2,4,6,10,14,16,20-heptamethyldocosa-4,8,12,16-tetraenoic acid (PubChem CID 162920251) has the molecular formula C30H52O7 and a molecular weight of 524.74 g/mol. Its IUPAC name is (2R,3R,4E,6S,7S,8E,10S,11S,12E,14S,15R,16E,18R,20S)-3,7,11,15-tetrahydroxy-18-(hydroxymethyl)-2,4,6,10,14,16,20-heptamethyldocosa-4,8,12,16-tetraenoic acid.
| Compound Name | (2R,3R,4E,6S,7S,8E,10S,11S,12E,14S,15R,16E,18R,20S)-3,7,11,15-tetrahydroxy-18-(hydroxymethyl)-2,4,6,10,14,16,20-heptamethyldocosa-4,8,12,16-tetraenoic acid |
|---|---|
| PubChem CID | 162920251 |
| Molecular Formula | C30H52O7 |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | (2R,3R,4E,6S,7S,8E,10S,11S,12E,14S,15R,16E,18R,20S)-3,7,11,15-tetrahydroxy-18-(hydroxymethyl)-2,4,6,10,14,16,20-heptamethyldocosa-4,8,12,16-tetraenoic acid |
| SMILES | CC[C@H](C)CC(/C=C(\C)[C@H](O)[C@@H](C)/C=C/[C@H](O)[C@@H](C)/C=C/[C@H](O)[C@@H](C)/C=C(\C)[C@H](O)[C@@H](C)C(=O)O)CO |
| InChI | InChI=1S/C30H52O7/c1-9-18(2)14-25(17-31)16-23(7)28(34)20(4)11-13-26(32)19(3)10-12-27(33)21(5)15-22(6)29(35)24(8)30(36)37/h10-13,15-16,18-21,24-29,31-35H,9,14,17H2,1-8H3,(H,36,37)/b12-10+,13-11+,22-15+,23-16+/t18-,19-,20-,21-,24+,25?,26-,27-,28+,29-/m0/s1 |
| InChIKey | UHSVRGKIDHLSHC-RAPZDVRHSA-N |
| XLogP | 4.11 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|