C14H24O5 — CID 10516329
diethyl 2-[(E)-5-hydroxy-4-methylhex-3-enyl]propanedioate (PubChem CID 10516329) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is diethyl 2-[(E)-5-hydroxy-4-methylhex-3-enyl]propanedioate.
| Compound Name | diethyl 2-[(E)-5-hydroxy-4-methylhex-3-enyl]propanedioate |
|---|---|
| PubChem CID | 10516329 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | diethyl 2-[(E)-5-hydroxy-4-methylhex-3-enyl]propanedioate |
| SMILES | CCOC(=O)C(CC/C=C(\C)C(C)O)C(=O)OCC |
| InChI | InChI=1S/C14H24O5/c1-5-18-13(16)12(14(17)19-6-2)9-7-8-10(3)11(4)15/h8,11-12,15H,5-7,9H2,1-4H3/b10-8+ |
| InChIKey | BKKUKQOYXHEAHG-CSKARUKUSA-N |
| XLogP | 1.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|