C31H20ClN3O5S — CID 24814256
N-[(3R,4R)-7-chloro-4-(4-nitrophenyl)-2,5-dioxo-1-phenyl-3,4-dihydrothiochromeno[2,3-b]pyridin-3-yl]benzamide (PubChem CID 24814256) has the molecular formula C31H20ClN3O5S and a molecular weight of 582.04 g/mol. Its IUPAC name is N-[(3R,4R)-7-chloro-4-(4-nitrophenyl)-2,5-dioxo-1-phenyl-3,4-dihydrothiochromeno[2,3-b]pyridin-3-yl]benzamide.
| Compound Name | N-[(3R,4R)-7-chloro-4-(4-nitrophenyl)-2,5-dioxo-1-phenyl-3,4-dihydrothiochromeno[2,3-b]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 24814256 |
| Molecular Formula | C31H20ClN3O5S |
| Molecular Weight | 582.04 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | N-[(3R,4R)-7-chloro-4-(4-nitrophenyl)-2,5-dioxo-1-phenyl-3,4-dihydrothiochromeno[2,3-b]pyridin-3-yl]benzamide |
| SMILES | O=C(N[C@H]1C(=O)N(c2ccccc2)c2sc3ccc(Cl)cc3c(=O)c2[C@H]1c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C31H20ClN3O5S/c32-20-13-16-24-23(17-20)28(36)26-25(18-11-14-22(15-12-18)35(39)40)27(33-29(37)19-7-3-1-4-8-19)30(38)34(31(26)41-24)21-9-5-2-6-10-21/h1-17,25,27H,(H,33,37)/t25-,27-/m1/s1 |
| InChIKey | LJOLWRBNBKIRAU-XNMGPUDCSA-N |
| XLogP | 6.43 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.04 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|