C23H21N3O6 — CID 71739636
methyl (6R,7R)-6-benzamido-7-(4-nitrophenyl)-5-oxo-2,3,6,7-tetrahydro-1H-indolizine-8-carboxylate (PubChem CID 71739636) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is methyl (6R,7R)-6-benzamido-7-(4-nitrophenyl)-5-oxo-2,3,6,7-tetrahydro-1H-indolizine-8-carboxylate.
| Compound Name | methyl (6R,7R)-6-benzamido-7-(4-nitrophenyl)-5-oxo-2,3,6,7-tetrahydro-1H-indolizine-8-carboxylate |
|---|---|
| PubChem CID | 71739636 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | methyl (6R,7R)-6-benzamido-7-(4-nitrophenyl)-5-oxo-2,3,6,7-tetrahydro-1H-indolizine-8-carboxylate |
| SMILES | COC(=O)C1=C2CCCN2C(=O)[C@H](NC(=O)c2ccccc2)[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H21N3O6/c1-32-23(29)19-17-8-5-13-25(17)22(28)20(24-21(27)15-6-3-2-4-7-15)18(19)14-9-11-16(12-10-14)26(30)31/h2-4,6-7,9-12,18,20H,5,8,13H2,1H3,(H,24,27)/t18-,20-/m1/s1 |
| InChIKey | NEIDZBFXZRTUMO-UYAOXDASSA-N |
| XLogP | 2.54 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|