C19H19N5OS2 — CID 24814937
1-[4-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]phenyl]-3-prop-2-enylthiourea (PubChem CID 24814937) has the molecular formula C19H19N5OS2 and a molecular weight of 397.53 g/mol. Its IUPAC name is 1-[4-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]phenyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[4-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]phenyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 24814937 |
| Molecular Formula | C19H19N5OS2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 1-[4-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]phenyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc(OCc2n[nH]c(=S)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N5OS2/c1-2-12-20-18(26)21-14-8-10-16(11-9-14)25-13-17-22-23-19(27)24(17)15-6-4-3-5-7-15/h2-11H,1,12-13H2,(H,23,27)(H2,20,21,26) |
| InChIKey | LVYJKEWKKMRYMV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|