C22H44O2Si2 — CID 24823371
tert-butyl-dimethyl-[[(1S,5R,6R,7R)-7-tri(propan-2-yl)silyloxy-6-bicyclo[3.2.0]hept-2-enyl]oxy]silane (PubChem CID 24823371) has the molecular formula C22H44O2Si2 and a molecular weight of 396.76 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,5R,6R,7R)-7-tri(propan-2-yl)silyloxy-6-bicyclo[3.2.0]hept-2-enyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,5R,6R,7R)-7-tri(propan-2-yl)silyloxy-6-bicyclo[3.2.0]hept-2-enyl]oxy]silane |
|---|---|
| PubChem CID | 24823371 |
| Molecular Formula | C22H44O2Si2 |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,5R,6R,7R)-7-tri(propan-2-yl)silyloxy-6-bicyclo[3.2.0]hept-2-enyl]oxy]silane |
| SMILES | CC(C)[Si](O[C@@H]1[C@H]2C=CC[C@H]2[C@H]1O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H44O2Si2/c1-15(2)26(16(3)4,17(5)6)24-21-19-14-12-13-18(19)20(21)23-25(10,11)22(7,8)9/h12,14-21H,13H2,1-11H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | ZQAWWDGOXPJFHD-PLACYPQZSA-N |
| XLogP | 7.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|