C17H34O2Si2 — CID 11427377
tert-butyl-dimethyl-[(1R,2R)-2-prop-2-enyl-4-trimethylsilyloxycyclopent-3-en-1-yl]oxysilane (PubChem CID 11427377) has the molecular formula C17H34O2Si2 and a molecular weight of 326.63 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,2R)-2-prop-2-enyl-4-trimethylsilyloxycyclopent-3-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,2R)-2-prop-2-enyl-4-trimethylsilyloxycyclopent-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 11427377 |
| Molecular Formula | C17H34O2Si2 |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,2R)-2-prop-2-enyl-4-trimethylsilyloxycyclopent-3-en-1-yl]oxysilane |
| SMILES | C=CC[C@@H]1C=C(O[Si](C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O2Si2/c1-10-11-14-12-15(18-20(5,6)7)13-16(14)19-21(8,9)17(2,3)4/h10,12,14,16H,1,11,13H2,2-9H3/t14-,16-/m1/s1 |
| InChIKey | LGPQLHUSHANWCU-GDBMZVCRSA-N |
| XLogP | 5.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|