C18H34O2Si2 — CID 11405017
(3E,4S,5R)-3-ethylidene-5-[1-[(3E,4S,5S)-3-ethylidene-2,2,4-trimethyloxasilolan-5-yl]ethyl]-2,2,4-trimethyloxasilolane (PubChem CID 11405017) has the molecular formula C18H34O2Si2 and a molecular weight of 338.64 g/mol. Its IUPAC name is (3E,4S,5R)-3-ethylidene-5-[1-[(3E,4S,5S)-3-ethylidene-2,2,4-trimethyloxasilolan-5-yl]ethyl]-2,2,4-trimethyloxasilolane.
| Compound Name | (3E,4S,5R)-3-ethylidene-5-[1-[(3E,4S,5S)-3-ethylidene-2,2,4-trimethyloxasilolan-5-yl]ethyl]-2,2,4-trimethyloxasilolane |
|---|---|
| PubChem CID | 11405017 |
| Molecular Formula | C18H34O2Si2 |
| Molecular Weight | 338.64 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (3E,4S,5R)-3-ethylidene-5-[1-[(3E,4S,5S)-3-ethylidene-2,2,4-trimethyloxasilolan-5-yl]ethyl]-2,2,4-trimethyloxasilolane |
| SMILES | C/C=C1\[C@@H](C)[C@@H](C(C)[C@@H]2O[Si](C)(C)/C(=C/C)[C@H]2C)O[Si]1(C)C |
| InChI | InChI=1S/C18H34O2Si2/c1-10-15-12(3)17(19-21(15,6)7)14(5)18-13(4)16(11-2)22(8,9)20-18/h10-14,17-18H,1-9H3/b15-10+,16-11+/t12-,13-,14?,17-,18+/m1/s1 |
| InChIKey | GFUUTCDPZOADEO-BTGGGRHUSA-N |
| XLogP | 5.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|