C17H19ClN2O2 — CID 24824018
ethyl 5-methyl-5,10-diazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,8,11,13-pentaene-3-carboxylate;hydrochloride (PubChem CID 24824018) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is ethyl 5-methyl-5,10-diazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,8,11,13-pentaene-3-carboxylate;hydrochloride.
| Compound Name | ethyl 5-methyl-5,10-diazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,8,11,13-pentaene-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 24824018 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | ethyl 5-methyl-5,10-diazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,8,11,13-pentaene-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1=C2c3cccc4[nH]cc(c34)CC2N(C)C1.Cl |
| InChI | InChI=1S/C17H18N2O2.ClH/c1-3-21-17(20)12-9-19(2)14-7-10-8-18-13-6-4-5-11(15(10)13)16(12)14;/h4-6,8,14,18H,3,7,9H2,1-2H3;1H |
| InChIKey | LOIWDEZFKSSIBW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |