C27H30N4O4S — CID 24824208
2-[4-[4-(pyrazolo[1,5-a]pyridin-2-ylmethyl)piperazin-1-yl]phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 24824208) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is 2-[4-[4-(pyrazolo[1,5-a]pyridin-2-ylmethyl)piperazin-1-yl]phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-[4-(pyrazolo[1,5-a]pyridin-2-ylmethyl)piperazin-1-yl]phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 24824208 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 2-[4-[4-(pyrazolo[1,5-a]pyridin-2-ylmethyl)piperazin-1-yl]phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccc(N3CCN(Cc4cc5ccccn5n4)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H30N4O4S/c1-22-5-11-27(12-6-22)36(32,33)35-19-18-34-26-9-7-24(8-10-26)30-16-14-29(15-17-30)21-23-20-25-4-2-3-13-31(25)28-23/h2-13,20H,14-19,21H2,1H3 |
| InChIKey | WTERXMLGLJFTJG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|