C20H17F3N2O3 — CID 24829052
[4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate (PubChem CID 24829052) has the molecular formula C20H17F3N2O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 24829052 |
| Molecular Formula | C20H17F3N2O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate |
| SMILES | CC(=O)N1N=C(C)CC1c1ccc(OC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H17F3N2O3/c1-12-11-18(25(24-12)13(2)26)14-5-9-17(10-6-14)28-19(27)15-3-7-16(8-4-15)20(21,22)23/h3-10,18H,11H2,1-2H3 |
| InChIKey | XDLWEMBZOVJLET-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|