About [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate
[4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate (PubChem CID 24829052) has the molecular formula C20H17F3N2O3
and a molecular weight of 390.36 g/mol. Its IUPAC name is [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate |
| PubChem CID | 24829052 |
| Molecular Formula | C20H17F3N2O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate |
| SMILES | CC(=O)N1N=C(C)CC1c1ccc(OC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H17F3N2O3/c1-12-11-18(25(24-12)13(2)26)14-5-9-17(10-6-14)28-19(27)15-3-7-16(8-4-15)20(21,22)23/h3-10,18H,11H2,1-2H3 |
| InChIKey | XDLWEMBZOVJLET-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate?
The IUPAC name of [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate (CID 24829052) is [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate.
What is the SMILES notation for [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate?
The canonical SMILES for [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate is CC(=O)N1N=C(C)CC1c1ccc(OC(=O)c2ccc(C(F)(F)F)cc2)cc1.
What is the InChIKey of [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate?
The InChIKey is XDLWEMBZOVJLET-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F3N2O3/c1-12-11-18(25(24-12)13(2)26)14-5-9-17(10-6-14)28-19(27)15-3-7-16(8-4-15)20(21,22)23/h3-10,18H,11H2,1-2H3.
What are the key properties of [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate?
[4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate has a molecular weight of 390.36 g/mol, XLogP of 4.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-acetyl-5-methyl-3,4-dihydropyrazol-3-yl)phenyl] 4-(trifluoromethyl)benzoate is sourced from PubChem (CID 24829052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).