C20H32N2O4 — CID 24829356
4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-1,7,8,9,10-pentamethyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 24829356) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-1,7,8,9,10-pentamethyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-1,7,8,9,10-pentamethyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 24829356 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-1,7,8,9,10-pentamethyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC1=C(C)C2(C)C3C(=O)N(OCC(O)CNC(C)C)C(=O)C3C1(C)C2C |
| InChI | InChI=1S/C20H32N2O4/c1-10(2)21-8-14(23)9-26-22-17(24)15-16(18(22)25)20(7)12(4)11(3)19(15,6)13(20)5/h10,13-16,21,23H,8-9H2,1-7H3 |
| InChIKey | DDWXWBSPQMHTJB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|