C17H13I3NNaO4 — CID 24832473
sodium 2-[3-(ethylcarbamoyl)-2,4,6-triiodophenoxy]-2-phenylacetate (PubChem CID 24832473) has the molecular formula C17H13I3NNaO4 and a molecular weight of 699.00 g/mol. Its IUPAC name is sodium 2-[3-(ethylcarbamoyl)-2,4,6-triiodophenoxy]-2-phenylacetate.
| Compound Name | sodium 2-[3-(ethylcarbamoyl)-2,4,6-triiodophenoxy]-2-phenylacetate |
|---|---|
| PubChem CID | 24832473 |
| Molecular Formula | C17H13I3NNaO4 |
| Molecular Weight | 699.00 g/mol |
| Exact Mass | 698.79 |
| IUPAC Name | sodium 2-[3-(ethylcarbamoyl)-2,4,6-triiodophenoxy]-2-phenylacetate |
| SMILES | CCNC(=O)c1c(I)cc(I)c(OC(C(=O)[O-])c2ccccc2)c1I.[Na+] |
| InChI | InChI=1S/C17H14I3NO4.Na/c1-2-21-16(22)12-10(18)8-11(19)15(13(12)20)25-14(17(23)24)9-6-4-3-5-7-9;/h3-8,14H,2H2,1H3,(H,21,22)(H,23,24);/q;+1/p-1 |
| InChIKey | JLQYERFCPQHYHN-UHFFFAOYSA-M |
| XLogP | 0.12 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.00 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|