C23H32INO5 — CID 24833138
diethyl-methyl-[2-phenyl-2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium iodide (PubChem CID 24833138) has the molecular formula C23H32INO5 and a molecular weight of 529.42 g/mol. Its IUPAC name is diethyl-methyl-[2-phenyl-2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium iodide.
| Compound Name | diethyl-methyl-[2-phenyl-2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium iodide |
|---|---|
| PubChem CID | 24833138 |
| Molecular Formula | C23H32INO5 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | diethyl-methyl-[2-phenyl-2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium iodide |
| SMILES | CC[N+](C)(CC)CC(OC(=O)c1cc(OC)c(OC)c(OC)c1)c1ccccc1.[I-] |
| InChI | InChI=1S/C23H32NO5.HI/c1-7-24(3,8-2)16-21(17-12-10-9-11-13-17)29-23(25)18-14-19(26-4)22(28-6)20(15-18)27-5;/h9-15,21H,7-8,16H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | IUONSPHJTIXCEL-UHFFFAOYSA-M |
| XLogP | 1.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|