C24H23NO7 — CID 3038982
[2-oxo-1-phenyl-2-(pyridin-2-ylmethoxy)ethyl] 3,4,5-trimethoxybenzoate (PubChem CID 3038982) has the molecular formula C24H23NO7 and a molecular weight of 437.45 g/mol. Its IUPAC name is [2-oxo-1-phenyl-2-(pyridin-2-ylmethoxy)ethyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-oxo-1-phenyl-2-(pyridin-2-ylmethoxy)ethyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3038982 |
| Molecular Formula | C24H23NO7 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | [2-oxo-1-phenyl-2-(pyridin-2-ylmethoxy)ethyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OC(C(=O)OCc2ccccn2)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23NO7/c1-28-19-13-17(14-20(29-2)22(19)30-3)23(26)32-21(16-9-5-4-6-10-16)24(27)31-15-18-11-7-8-12-25-18/h4-14,21H,15H2,1-3H3 |
| InChIKey | VSJBAXXKTIASOR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |