C16H25N2O2+ — CID 24833465
[4-(dimethylcarbamoyloxy)phenyl]-diethyl-prop-2-enylazanium (PubChem CID 24833465) has the molecular formula C16H25N2O2+ and a molecular weight of 277.39 g/mol. Its IUPAC name is [4-(dimethylcarbamoyloxy)phenyl]-diethyl-prop-2-enylazanium.
| Compound Name | [4-(dimethylcarbamoyloxy)phenyl]-diethyl-prop-2-enylazanium |
|---|---|
| PubChem CID | 24833465 |
| Molecular Formula | C16H25N2O2+ |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | [4-(dimethylcarbamoyloxy)phenyl]-diethyl-prop-2-enylazanium |
| SMILES | C=CC[N+](CC)(CC)c1ccc(OC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C16H25N2O2/c1-6-13-18(7-2,8-3)14-9-11-15(12-10-14)20-16(19)17(4)5/h6,9-12H,1,7-8,13H2,2-5H3/q+1 |
| InChIKey | MIXCOCUWHXKCLF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|