C10H15N2NaO3 — CID 24834177
sodium 5-methyl-5-pentan-3-ylpyrimidin-3-ide-2,4,6-trione (PubChem CID 24834177) has the molecular formula C10H15N2NaO3 and a molecular weight of 234.23 g/mol. Its IUPAC name is sodium 5-methyl-5-pentan-3-ylpyrimidin-3-ide-2,4,6-trione.
| Compound Name | sodium 5-methyl-5-pentan-3-ylpyrimidin-3-ide-2,4,6-trione |
|---|---|
| PubChem CID | 24834177 |
| Molecular Formula | C10H15N2NaO3 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | sodium 5-methyl-5-pentan-3-ylpyrimidin-3-ide-2,4,6-trione |
| SMILES | CCC(CC)C1(C)C(=O)[N-]C(=O)NC1=O.[Na+] |
| InChI | InChI=1S/C10H16N2O3.Na/c1-4-6(5-2)10(3)7(13)11-9(15)12-8(10)14;/h6H,4-5H2,1-3H3,(H2,11,12,13,14,15);/q;+1/p-1 |
| InChIKey | DHQZYPUEHAOMBH-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|