C8H11N2NaO4 — CID 24834157
sodium 5-ethyl-5-(2-hydroxyethyl)pyrimidin-3-ide-2,4,6-trione (PubChem CID 24834157) has the molecular formula C8H11N2NaO4 and a molecular weight of 222.18 g/mol. Its IUPAC name is sodium 5-ethyl-5-(2-hydroxyethyl)pyrimidin-3-ide-2,4,6-trione.
| Compound Name | sodium 5-ethyl-5-(2-hydroxyethyl)pyrimidin-3-ide-2,4,6-trione |
|---|---|
| PubChem CID | 24834157 |
| Molecular Formula | C8H11N2NaO4 |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | sodium 5-ethyl-5-(2-hydroxyethyl)pyrimidin-3-ide-2,4,6-trione |
| SMILES | CCC1(CCO)C(=O)[N-]C(=O)NC1=O.[Na+] |
| InChI | InChI=1S/C8H12N2O4.Na/c1-2-8(3-4-11)5(12)9-7(14)10-6(8)13;/h11H,2-4H2,1H3,(H2,9,10,12,13,14);/q;+1/p-1 |
| InChIKey | YORQJLWHWLXFIR-UHFFFAOYSA-M |
| XLogP | -3.08 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|