C22H42Cl2N2O4 — CID 24837362
dimethyl 2,9-di(piperidin-2-yl)decanedioate;dihydrochloride (PubChem CID 24837362) has the molecular formula C22H42Cl2N2O4 and a molecular weight of 469.49 g/mol. Its IUPAC name is dimethyl 2,9-di(piperidin-2-yl)decanedioate;dihydrochloride.
| Compound Name | dimethyl 2,9-di(piperidin-2-yl)decanedioate;dihydrochloride |
|---|---|
| PubChem CID | 24837362 |
| Molecular Formula | C22H42Cl2N2O4 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | dimethyl 2,9-di(piperidin-2-yl)decanedioate;dihydrochloride |
| SMILES | COC(=O)C(CCCCCCC(C(=O)OC)C1CCCCN1)C1CCCCN1.Cl.Cl |
| InChI | InChI=1S/C22H40N2O4.2ClH/c1-27-21(25)17(19-13-7-9-15-23-19)11-5-3-4-6-12-18(22(26)28-2)20-14-8-10-16-24-20;;/h17-20,23-24H,3-16H2,1-2H3;2*1H |
| InChIKey | RFCLBEGDOAZDAZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|