C19H36Cl2N2O4 — CID 24838597
dimethyl 2,6-di(piperidin-2-yl)heptanedioate;dihydrochloride (PubChem CID 24838597) has the molecular formula C19H36Cl2N2O4 and a molecular weight of 427.41 g/mol. Its IUPAC name is dimethyl 2,6-di(piperidin-2-yl)heptanedioate;dihydrochloride.
| Compound Name | dimethyl 2,6-di(piperidin-2-yl)heptanedioate;dihydrochloride |
|---|---|
| PubChem CID | 24838597 |
| Molecular Formula | C19H36Cl2N2O4 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | dimethyl 2,6-di(piperidin-2-yl)heptanedioate;dihydrochloride |
| SMILES | COC(=O)C(CCCC(C(=O)OC)C1CCCCN1)C1CCCCN1.Cl.Cl |
| InChI | InChI=1S/C19H34N2O4.2ClH/c1-24-18(22)14(16-10-3-5-12-20-16)8-7-9-15(19(23)25-2)17-11-4-6-13-21-17;;/h14-17,20-21H,3-13H2,1-2H3;2*1H |
| InChIKey | PBAMOPLTROENEI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |