C15H14NNaO4S — CID 24838858
sodium 3-(4-aminophenyl)sulfonyl-3-phenylpropanoate (PubChem CID 24838858) has the molecular formula C15H14NNaO4S and a molecular weight of 327.34 g/mol. Its IUPAC name is sodium 3-(4-aminophenyl)sulfonyl-3-phenylpropanoate.
| Compound Name | sodium 3-(4-aminophenyl)sulfonyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 24838858 |
| Molecular Formula | C15H14NNaO4S |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | sodium 3-(4-aminophenyl)sulfonyl-3-phenylpropanoate |
| SMILES | Nc1ccc(S(=O)(=O)C(CC(=O)[O-])c2ccccc2)cc1.[Na+] |
| InChI | InChI=1S/C15H15NO4S.Na/c16-12-6-8-13(9-7-12)21(19,20)14(10-15(17)18)11-4-2-1-3-5-11;/h1-9,14H,10,16H2,(H,17,18);/q;+1/p-1 |
| InChIKey | TXEQISZXBFRBTH-UHFFFAOYSA-M |
| XLogP | -2.07 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|