C16H15ClN2O3 — CID 24839608
methyl 12-chloro-2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-4-carboxylate (PubChem CID 24839608) has the molecular formula C16H15ClN2O3 and a molecular weight of 318.76 g/mol. Its IUPAC name is methyl 12-chloro-2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-4-carboxylate.
| Compound Name | methyl 12-chloro-2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 24839608 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | methyl 12-chloro-2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-4-carboxylate |
| SMILES | COC(=O)C1CC(=O)n2c3c(c4cc(Cl)ccc42)CCNC31 |
| InChI | InChI=1S/C16H15ClN2O3/c1-22-16(21)11-7-13(20)19-12-3-2-8(17)6-10(12)9-4-5-18-14(11)15(9)19/h2-3,6,11,14,18H,4-5,7H2,1H3 |
| InChIKey | UUBIPWORYDNUGD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |