C23H26N2O4 — CID 24841836
(4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-(3-methoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one (PubChem CID 24841836) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-(3-methoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-(3-methoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
|---|---|
| PubChem CID | 24841836 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-(3-methoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
| SMILES | COc1cccc(N2N=C(c3ccc(OC)c(OC)c3)[C@H]3CCCC[C@H]3C2=O)c1 |
| InChI | InChI=1S/C23H26N2O4/c1-27-17-8-6-7-16(14-17)25-23(26)19-10-5-4-9-18(19)22(24-25)15-11-12-20(28-2)21(13-15)29-3/h6-8,11-14,18-19H,4-5,9-10H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | WHQRYZZAAWTLRQ-RBUKOAKNSA-N |
| XLogP | 4.27 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |