C16H27F3N4O8S2 — CID 24843233
[(2S)-3-[2-[2-[[(2S)-3-acetyloxy-2-aminopropanoyl]amino]ethyldisulfanyl]ethylamino]-2-amino-3-oxopropyl] acetate;2,2,2-trifluoroacetic acid (PubChem CID 24843233) has the molecular formula C16H27F3N4O8S2 and a molecular weight of 524.54 g/mol. Its IUPAC name is [(2S)-3-[2-[2-[[(2S)-3-acetyloxy-2-aminopropanoyl]amino]ethyldisulfanyl]ethylamino]-2-amino-3-oxopropyl] acetate;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S)-3-[2-[2-[[(2S)-3-acetyloxy-2-aminopropanoyl]amino]ethyldisulfanyl]ethylamino]-2-amino-3-oxopropyl] acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24843233 |
| Molecular Formula | C16H27F3N4O8S2 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | [(2S)-3-[2-[2-[[(2S)-3-acetyloxy-2-aminopropanoyl]amino]ethyldisulfanyl]ethylamino]-2-amino-3-oxopropyl] acetate;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)OC[C@H](N)C(=O)NCCSSCCNC(=O)[C@@H](N)COC(C)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H26N4O6S2.C2HF3O2/c1-9(19)23-7-11(15)13(21)17-3-5-25-26-6-4-18-14(22)12(16)8-24-10(2)20;3-2(4,5)1(6)7/h11-12H,3-8,15-16H2,1-2H3,(H,17,21)(H,18,22);(H,6,7)/t11-,12-;/m0./s1 |
| InChIKey | KEHCGXGUZUCIKO-FXMYHANSSA-N |
| XLogP | -0.99 |
| TPSA | 200.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|