C19H31NO — CID 24847310
2-[cyclohexyl(phenyl)methoxy]-N,N-diethylethanamine (PubChem CID 24847310) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 2-[cyclohexyl(phenyl)methoxy]-N,N-diethylethanamine.
| Compound Name | 2-[cyclohexyl(phenyl)methoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 24847310 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 2-[cyclohexyl(phenyl)methoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOC(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C19H31NO/c1-3-20(4-2)15-16-21-19(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5,7-8,11-12,18-19H,3-4,6,9-10,13-16H2,1-2H3 |
| InChIKey | DUPYCATWTCGHMB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |