C7H15Cl2NO — CID 24847318
N,N-bis(2-chloroethyl)propan-2-amine oxide (PubChem CID 24847318) has the molecular formula C7H15Cl2NO and a molecular weight of 200.11 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)propan-2-amine oxide.
| Compound Name | N,N-bis(2-chloroethyl)propan-2-amine oxide |
|---|---|
| PubChem CID | 24847318 |
| Molecular Formula | C7H15Cl2NO |
| Molecular Weight | 200.11 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | N,N-bis(2-chloroethyl)propan-2-amine oxide |
| SMILES | CC(C)[N+]([O-])(CCCl)CCCl |
| InChI | InChI=1S/C7H15Cl2NO/c1-7(2)10(11,5-3-8)6-4-9/h7H,3-6H2,1-2H3 |
| InChIKey | JMCWCXOPUMKGEU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.11 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|