C26H30F3N3O3 — CID 24852714
N-phenyl-2-piperidin-1-yl-N-[1-(3,4,5-trifluoro-2-methoxybenzoyl)piperidin-4-yl]acetamide (PubChem CID 24852714) has the molecular formula C26H30F3N3O3 and a molecular weight of 489.54 g/mol. Its IUPAC name is N-phenyl-2-piperidin-1-yl-N-[1-(3,4,5-trifluoro-2-methoxybenzoyl)piperidin-4-yl]acetamide.
| Compound Name | N-phenyl-2-piperidin-1-yl-N-[1-(3,4,5-trifluoro-2-methoxybenzoyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 24852714 |
| Molecular Formula | C26H30F3N3O3 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-phenyl-2-piperidin-1-yl-N-[1-(3,4,5-trifluoro-2-methoxybenzoyl)piperidin-4-yl]acetamide |
| SMILES | COc1c(C(=O)N2CCC(N(C(=O)CN3CCCCC3)c3ccccc3)CC2)cc(F)c(F)c1F |
| InChI | InChI=1S/C26H30F3N3O3/c1-35-25-20(16-21(27)23(28)24(25)29)26(34)31-14-10-19(11-15-31)32(18-8-4-2-5-9-18)22(33)17-30-12-6-3-7-13-30/h2,4-5,8-9,16,19H,3,6-7,10-15,17H2,1H3 |
| InChIKey | UYTRNVLCEDCCHM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|