C27H25N3O2 — CID 24854136
4-[(1R,2S,6R,9R)-4,11-diphenyl-5,10-dioxa-4,11-diazatricyclo[7.2.1.02,6]dodecan-3-yl]benzonitrile (PubChem CID 24854136) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-[(1R,2S,6R,9R)-4,11-diphenyl-5,10-dioxa-4,11-diazatricyclo[7.2.1.02,6]dodecan-3-yl]benzonitrile.
| Compound Name | 4-[(1R,2S,6R,9R)-4,11-diphenyl-5,10-dioxa-4,11-diazatricyclo[7.2.1.02,6]dodecan-3-yl]benzonitrile |
|---|---|
| PubChem CID | 24854136 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-[(1R,2S,6R,9R)-4,11-diphenyl-5,10-dioxa-4,11-diazatricyclo[7.2.1.02,6]dodecan-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2[C@@H]3[C@H]4C[C@@H](CC[C@H]3ON2c2ccccc2)ON4c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25N3O2/c28-18-19-11-13-20(14-12-19)27-26-24-17-23(31-29(24)21-7-3-1-4-8-21)15-16-25(26)32-30(27)22-9-5-2-6-10-22/h1-14,23-27H,15-17H2/t23-,24-,25-,26-,27?/m1/s1 |
| InChIKey | VJKBBDXLXVASCZ-OGJKZRMOSA-N |
| XLogP | 5.41 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |