C16H10N4OS — CID 24855049
3-(4-pyrimidin-5-ylthieno[3,2-d]pyrimidin-2-yl)phenol (PubChem CID 24855049) has the molecular formula C16H10N4OS and a molecular weight of 306.35 g/mol. Its IUPAC name is 3-(4-pyrimidin-5-ylthieno[3,2-d]pyrimidin-2-yl)phenol.
| Compound Name | 3-(4-pyrimidin-5-ylthieno[3,2-d]pyrimidin-2-yl)phenol |
|---|---|
| PubChem CID | 24855049 |
| Molecular Formula | C16H10N4OS |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 3-(4-pyrimidin-5-ylthieno[3,2-d]pyrimidin-2-yl)phenol |
| SMILES | Oc1cccc(-c2nc(-c3cncnc3)c3sccc3n2)c1 |
| InChI | InChI=1S/C16H10N4OS/c21-12-3-1-2-10(6-12)16-19-13-4-5-22-15(13)14(20-16)11-7-17-9-18-8-11/h1-9,21H |
| InChIKey | HWCWGIPSZQGRNZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |