C14H8N2O2S2 — CID 78960928
3-(5-thieno[3,2-b]thiophen-5-yl-1,2,4-oxadiazol-3-yl)phenol (PubChem CID 78960928) has the molecular formula C14H8N2O2S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-(5-thieno[3,2-b]thiophen-5-yl-1,2,4-oxadiazol-3-yl)phenol.
| Compound Name | 3-(5-thieno[3,2-b]thiophen-5-yl-1,2,4-oxadiazol-3-yl)phenol |
|---|---|
| PubChem CID | 78960928 |
| Molecular Formula | C14H8N2O2S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 3-(5-thieno[3,2-b]thiophen-5-yl-1,2,4-oxadiazol-3-yl)phenol |
| SMILES | Oc1cccc(-c2noc(-c3cc4sccc4s3)n2)c1 |
| InChI | InChI=1S/C14H8N2O2S2/c17-9-3-1-2-8(6-9)13-15-14(18-16-13)12-7-11-10(20-12)4-5-19-11/h1-7,17H |
| InChIKey | GOWCZGNVJQOEEO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |