C24H28N4O2S — CID 24859570
6-(cyclopentanecarbonyl)-3-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 24859570) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 6-(cyclopentanecarbonyl)-3-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 6-(cyclopentanecarbonyl)-3-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24859570 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 6-(cyclopentanecarbonyl)-3-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | CN1CCCN(c2ccc(-n3cnc4cc(C(=O)C5CCCC5)sc4c3=O)cc2)CC1 |
| InChI | InChI=1S/C24H28N4O2S/c1-26-11-4-12-27(14-13-26)18-7-9-19(10-8-18)28-16-25-20-15-21(31-23(20)24(28)30)22(29)17-5-2-3-6-17/h7-10,15-17H,2-6,11-14H2,1H3 |
| InChIKey | IYKXWCLQWRFBOX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|