C21H24N2O2S — CID 24860772
3-(benzenesulfonyl)-6-(2-piperidin-1-ylethyl)-1H-indole (PubChem CID 24860772) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-6-(2-piperidin-1-ylethyl)-1H-indole.
| Compound Name | 3-(benzenesulfonyl)-6-(2-piperidin-1-ylethyl)-1H-indole |
|---|---|
| PubChem CID | 24860772 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3-(benzenesulfonyl)-6-(2-piperidin-1-ylethyl)-1H-indole |
| SMILES | O=S(=O)(c1ccccc1)c1c[nH]c2cc(CCN3CCCCC3)ccc12 |
| InChI | InChI=1S/C21H24N2O2S/c24-26(25,18-7-3-1-4-8-18)21-16-22-20-15-17(9-10-19(20)21)11-14-23-12-5-2-6-13-23/h1,3-4,7-10,15-16,22H,2,5-6,11-14H2 |
| InChIKey | BMVOXKQVYHAXGL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |