C31H44N2O5S3 — CID 24862437
4-(2-benzylsulfanylethyl)-N-[(1R,2R)-2-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylsulfonylamino]cyclohexyl]benzenesulfonamide (PubChem CID 24862437) has the molecular formula C31H44N2O5S3 and a molecular weight of 620.90 g/mol. Its IUPAC name is 4-(2-benzylsulfanylethyl)-N-[(1R,2R)-2-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylsulfonylamino]cyclohexyl]benzenesulfonamide.
| Compound Name | 4-(2-benzylsulfanylethyl)-N-[(1R,2R)-2-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylsulfonylamino]cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24862437 |
| Molecular Formula | C31H44N2O5S3 |
| Molecular Weight | 620.90 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | 4-(2-benzylsulfanylethyl)-N-[(1R,2R)-2-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylsulfonylamino]cyclohexyl]benzenesulfonamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N[C@@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(CCSCc3ccccc3)cc1)[C@H](O)C2 |
| InChI | InChI=1S/C31H44N2O5S3/c1-30(2)25-16-18-31(30,29(34)20-25)22-40(35,36)32-27-10-6-7-11-28(27)33-41(37,38)26-14-12-23(13-15-26)17-19-39-21-24-8-4-3-5-9-24/h3-5,8-9,12-15,25,27-29,32-34H,6-7,10-11,16-22H2,1-2H3/t25-,27-,28-,29-,31-/m1/s1 |
| InChIKey | CTFKEROFKSWVPH-YMLRRHDESA-N |
| XLogP | 4.86 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.90 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|