C20H23NO5 — CID 24867671
9,10-dimethoxyspiro[3,6,7,11b-tetrahydro-2H-benzo[a]quinolizine-1,2'-cyclohexane]-1',3',4-trione (PubChem CID 24867671) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 9,10-dimethoxyspiro[3,6,7,11b-tetrahydro-2H-benzo[a]quinolizine-1,2'-cyclohexane]-1',3',4-trione.
| Compound Name | 9,10-dimethoxyspiro[3,6,7,11b-tetrahydro-2H-benzo[a]quinolizine-1,2'-cyclohexane]-1',3',4-trione |
|---|---|
| PubChem CID | 24867671 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 9,10-dimethoxyspiro[3,6,7,11b-tetrahydro-2H-benzo[a]quinolizine-1,2'-cyclohexane]-1',3',4-trione |
| SMILES | COc1cc2c(cc1OC)C1N(CC2)C(=O)CCC12C(=O)CCCC2=O |
| InChI | InChI=1S/C20H23NO5/c1-25-14-10-12-7-9-21-18(24)6-8-20(16(22)4-3-5-17(20)23)19(21)13(12)11-15(14)26-2/h10-11,19H,3-9H2,1-2H3 |
| InChIKey | LXJPGUXDFZTECS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|