C20H23NO5 — CID 11337252
methyl (12aR,12bR)-2,3-dimethoxy-8-oxo-5,6,10,11,12,12b-hexahydroisoindolo[1,2-a]isoquinoline-12a-carboxylate (PubChem CID 11337252) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is methyl (12aR,12bR)-2,3-dimethoxy-8-oxo-5,6,10,11,12,12b-hexahydroisoindolo[1,2-a]isoquinoline-12a-carboxylate.
| Compound Name | methyl (12aR,12bR)-2,3-dimethoxy-8-oxo-5,6,10,11,12,12b-hexahydroisoindolo[1,2-a]isoquinoline-12a-carboxylate |
|---|---|
| PubChem CID | 11337252 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | methyl (12aR,12bR)-2,3-dimethoxy-8-oxo-5,6,10,11,12,12b-hexahydroisoindolo[1,2-a]isoquinoline-12a-carboxylate |
| SMILES | COC(=O)[C@]12CCCC=C1C(=O)N1CCc3cc(OC)c(OC)cc3[C@@H]12 |
| InChI | InChI=1S/C20H23NO5/c1-24-15-10-12-7-9-21-17(13(12)11-16(15)25-2)20(19(23)26-3)8-5-4-6-14(20)18(21)22/h6,10-11,17H,4-5,7-9H2,1-3H3/t17-,20-/m1/s1 |
| InChIKey | AOJOYTUAWIIYHP-YLJYHZDGSA-N |
| XLogP | 2.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |