C30H30FNO3 — CID 24868103
2-benzyl-3-[4-(3,4-dimethoxyphenyl)-2-fluorophenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 24868103) has the molecular formula C30H30FNO3 and a molecular weight of 471.57 g/mol. Its IUPAC name is 2-benzyl-3-[4-(3,4-dimethoxyphenyl)-2-fluorophenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | 2-benzyl-3-[4-(3,4-dimethoxyphenyl)-2-fluorophenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 24868103 |
| Molecular Formula | C30H30FNO3 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 2-benzyl-3-[4-(3,4-dimethoxyphenyl)-2-fluorophenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | COc1ccc(-c2ccc(C3C4C=CCC(C)C4C(=O)N3Cc3ccccc3)c(F)c2)cc1OC |
| InChI | InChI=1S/C30H30FNO3/c1-19-8-7-11-24-28(19)30(33)32(18-20-9-5-4-6-10-20)29(24)23-14-12-21(16-25(23)31)22-13-15-26(34-2)27(17-22)35-3/h4-7,9-17,19,24,28-29H,8,18H2,1-3H3 |
| InChIKey | SMKIVOGOMKHMBF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|