C13H14N2O — CID 24871290
7-methoxy-1-methyl-4,4b-dihydro-3H-pyrido[3,4-b]indole (PubChem CID 24871290) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 7-methoxy-1-methyl-4,4b-dihydro-3H-pyrido[3,4-b]indole.
| Compound Name | 7-methoxy-1-methyl-4,4b-dihydro-3H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 24871290 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 7-methoxy-1-methyl-4,4b-dihydro-3H-pyrido[3,4-b]indole |
| SMILES | COC1=CC2=NC3=C(CCN=C3C)C2C=C1 |
| InChI | InChI=1S/C13H14N2O/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13/h3-4,7,10H,5-6H2,1-2H3 |
| InChIKey | FLMVTKWRNRTCGT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |