C24H25F3N6O4S — CID 24872485
N-pyrimidin-4-yl-4-[4-[2-[4-(trifluoromethoxy)anilino]propanoyl]piperazin-1-yl]benzenesulfonamide (PubChem CID 24872485) has the molecular formula C24H25F3N6O4S and a molecular weight of 550.56 g/mol. Its IUPAC name is N-pyrimidin-4-yl-4-[4-[2-[4-(trifluoromethoxy)anilino]propanoyl]piperazin-1-yl]benzenesulfonamide.
| Compound Name | N-pyrimidin-4-yl-4-[4-[2-[4-(trifluoromethoxy)anilino]propanoyl]piperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 24872485 |
| Molecular Formula | C24H25F3N6O4S |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | N-pyrimidin-4-yl-4-[4-[2-[4-(trifluoromethoxy)anilino]propanoyl]piperazin-1-yl]benzenesulfonamide |
| SMILES | CC(Nc1ccc(OC(F)(F)F)cc1)C(=O)N1CCN(c2ccc(S(=O)(=O)Nc3ccncn3)cc2)CC1 |
| InChI | InChI=1S/C24H25F3N6O4S/c1-17(30-18-2-6-20(7-3-18)37-24(25,26)27)23(34)33-14-12-32(13-15-33)19-4-8-21(9-5-19)38(35,36)31-22-10-11-28-16-29-22/h2-11,16-17,30H,12-15H2,1H3,(H,28,29,31) |
| InChIKey | OTGSPJLHZMWHAJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|